C29H44N4O4S — CID 142676608
N-butyl-2-[[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]amino]hexanamide (PubChem CID 142676608) has the molecular formula C29H44N4O4S and a molecular weight of 544.76 g/mol. Its IUPAC name is N-butyl-2-[[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]amino]hexanamide.
| Compound Name | N-butyl-2-[[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]amino]hexanamide |
|---|---|
| PubChem CID | 142676608 |
| Molecular Formula | C29H44N4O4S |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | N-butyl-2-[[1-[[4-[4-(methanesulfonamido)phenoxy]phenyl]methyl]piperidin-4-yl]amino]hexanamide |
| SMILES | CCCCNC(=O)C(CCCC)NC1CCN(Cc2ccc(Oc3ccc(NS(C)(=O)=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H44N4O4S/c1-4-6-8-28(29(34)30-19-7-5-2)31-24-17-20-33(21-18-24)22-23-9-13-26(14-10-23)37-27-15-11-25(12-16-27)32-38(3,35)36/h9-16,24,28,31-32H,4-8,17-22H2,1-3H3,(H,30,34) |
| InChIKey | WUHQQJHVYWJOQI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|