C27H24FN5 — CID 142678029
N-[[5-(2-fluorophenyl)-1-(4-phenylphenyl)pyrazol-4-yl]methyl]-2-(1H-imidazol-5-yl)ethanamine (PubChem CID 142678029) has the molecular formula C27H24FN5 and a molecular weight of 437.52 g/mol. Its IUPAC name is N-[[5-(2-fluorophenyl)-1-(4-phenylphenyl)pyrazol-4-yl]methyl]-2-(1H-imidazol-5-yl)ethanamine.
| Compound Name | N-[[5-(2-fluorophenyl)-1-(4-phenylphenyl)pyrazol-4-yl]methyl]-2-(1H-imidazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 142678029 |
| Molecular Formula | C27H24FN5 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[[5-(2-fluorophenyl)-1-(4-phenylphenyl)pyrazol-4-yl]methyl]-2-(1H-imidazol-5-yl)ethanamine |
| SMILES | Fc1ccccc1-c1c(CNCCc2cnc[nH]2)cnn1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24FN5/c28-26-9-5-4-8-25(26)27-22(16-29-15-14-23-18-30-19-31-23)17-32-33(27)24-12-10-21(11-13-24)20-6-2-1-3-7-20/h1-13,17-19,29H,14-16H2,(H,30,31) |
| InChIKey | ZHDLUVCOVDZIOZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|