C11H12N2O6 — CID 142678753
2-[2-[(2-aminoacetyl)amino]-2-hydroxyacetyl]oxybenzoic acid (PubChem CID 142678753) has the molecular formula C11H12N2O6 and a molecular weight of 268.23 g/mol. Its IUPAC name is 2-[2-[(2-aminoacetyl)amino]-2-hydroxyacetyl]oxybenzoic acid.
| Compound Name | 2-[2-[(2-aminoacetyl)amino]-2-hydroxyacetyl]oxybenzoic acid |
|---|---|
| PubChem CID | 142678753 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-[2-[(2-aminoacetyl)amino]-2-hydroxyacetyl]oxybenzoic acid |
| SMILES | NCC(=O)NC(O)C(=O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C11H12N2O6/c12-5-8(14)13-9(15)11(18)19-7-4-2-1-3-6(7)10(16)17/h1-4,9,15H,5,12H2,(H,13,14)(H,16,17) |
| InChIKey | QWHSOVNUUWDSAK-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|