C24H25N5O3 — CID 142679783
1-[2-[[3-(2-nitrophenyl)-1,2-oxazol-5-yl]methylamino]ethyl]-4-phenylpiperidine-4-carbonitrile (PubChem CID 142679783) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is 1-[2-[[3-(2-nitrophenyl)-1,2-oxazol-5-yl]methylamino]ethyl]-4-phenylpiperidine-4-carbonitrile.
| Compound Name | 1-[2-[[3-(2-nitrophenyl)-1,2-oxazol-5-yl]methylamino]ethyl]-4-phenylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 142679783 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-[2-[[3-(2-nitrophenyl)-1,2-oxazol-5-yl]methylamino]ethyl]-4-phenylpiperidine-4-carbonitrile |
| SMILES | N#CC1(c2ccccc2)CCN(CCNCc2cc(-c3ccccc3[N+](=O)[O-])no2)CC1 |
| InChI | InChI=1S/C24H25N5O3/c25-18-24(19-6-2-1-3-7-19)10-13-28(14-11-24)15-12-26-17-20-16-22(27-32-20)21-8-4-5-9-23(21)29(30)31/h1-9,16,26H,10-15,17H2 |
| InChIKey | HQVUXMYPVUMDLM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|