C6H8ClN3 — CID 142680004
5-chloro-6-methylpyridine-3,4-diamine (PubChem CID 142680004) has the molecular formula C6H8ClN3 and a molecular weight of 157.60 g/mol. Its IUPAC name is 5-chloro-6-methylpyridine-3,4-diamine.
| Compound Name | 5-chloro-6-methylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 142680004 |
| Molecular Formula | C6H8ClN3 |
| Molecular Weight | 157.60 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 5-chloro-6-methylpyridine-3,4-diamine |
| SMILES | Cc1ncc(N)c(N)c1Cl |
| InChI | InChI=1S/C6H8ClN3/c1-3-5(7)6(9)4(8)2-10-3/h2H,8H2,1H3,(H2,9,10) |
| InChIKey | ZCYCGLVGEUAYMZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.60 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |