C15H21N3O4 — CID 142680412
(E)-N'-hydroxy-N-(6-methoxy-3-pyridinyl)-2-methyloct-2-enediamide (PubChem CID 142680412) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is (E)-N'-hydroxy-N-(6-methoxy-3-pyridinyl)-2-methyloct-2-enediamide.
| Compound Name | (E)-N'-hydroxy-N-(6-methoxy-3-pyridinyl)-2-methyloct-2-enediamide |
|---|---|
| PubChem CID | 142680412 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | (E)-N'-hydroxy-N-(6-methoxy-3-pyridinyl)-2-methyloct-2-enediamide |
| SMILES | COc1ccc(NC(=O)/C(C)=C/CCCCC(=O)NO)cn1 |
| InChI | InChI=1S/C15H21N3O4/c1-11(6-4-3-5-7-13(19)18-21)15(20)17-12-8-9-14(22-2)16-10-12/h6,8-10,21H,3-5,7H2,1-2H3,(H,17,20)(H,18,19)/b11-6+ |
| InChIKey | NPZIRNSQGPVQKY-IZZDOVSWSA-N |
| XLogP | 2.04 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|