C23H26N2O4 — CID 142680485
(7S)-7-[4-(dimethylamino)phenyl]-8-(3-methoxyanilino)-8-oxoocta-2,4-dienoic acid (PubChem CID 142680485) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (7S)-7-[4-(dimethylamino)phenyl]-8-(3-methoxyanilino)-8-oxoocta-2,4-dienoic acid.
| Compound Name | (7S)-7-[4-(dimethylamino)phenyl]-8-(3-methoxyanilino)-8-oxoocta-2,4-dienoic acid |
|---|---|
| PubChem CID | 142680485 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (7S)-7-[4-(dimethylamino)phenyl]-8-(3-methoxyanilino)-8-oxoocta-2,4-dienoic acid |
| SMILES | COc1cccc(NC(=O)[C@@H](CC=CC=CC(=O)O)c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C23H26N2O4/c1-25(2)19-14-12-17(13-15-19)21(10-5-4-6-11-22(26)27)23(28)24-18-8-7-9-20(16-18)29-3/h4-9,11-16,21H,10H2,1-3H3,(H,24,28)(H,26,27)/t21-/m0/s1 |
| InChIKey | KULWJAQGFBSOHP-NRFANRHFSA-N |
| XLogP | 4.07 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|