C26H32N2O5 — CID 142680546
ethyl (7S)-8-(3,4-dimethoxyanilino)-7-[4-(dimethylamino)phenyl]-8-oxoocta-2,4-dienoate (PubChem CID 142680546) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is ethyl (7S)-8-(3,4-dimethoxyanilino)-7-[4-(dimethylamino)phenyl]-8-oxoocta-2,4-dienoate.
| Compound Name | ethyl (7S)-8-(3,4-dimethoxyanilino)-7-[4-(dimethylamino)phenyl]-8-oxoocta-2,4-dienoate |
|---|---|
| PubChem CID | 142680546 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | ethyl (7S)-8-(3,4-dimethoxyanilino)-7-[4-(dimethylamino)phenyl]-8-oxoocta-2,4-dienoate |
| SMILES | CCOC(=O)C=CC=CCC(C(=O)Nc1ccc(OC)c(OC)c1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C26H32N2O5/c1-6-33-25(29)11-9-7-8-10-22(19-12-15-21(16-13-19)28(2)3)26(30)27-20-14-17-23(31-4)24(18-20)32-5/h7-9,11-18,22H,6,10H2,1-5H3,(H,27,30) |
| InChIKey | LOWRICOJJAHMQH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|