C23H27N3O3 — CID 142680522
ethyl (7S)-7-[4-(dimethylamino)phenyl]-8-oxo-8-(pyridin-4-ylamino)octa-2,4-dienoate (PubChem CID 142680522) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is ethyl (7S)-7-[4-(dimethylamino)phenyl]-8-oxo-8-(pyridin-4-ylamino)octa-2,4-dienoate.
| Compound Name | ethyl (7S)-7-[4-(dimethylamino)phenyl]-8-oxo-8-(pyridin-4-ylamino)octa-2,4-dienoate |
|---|---|
| PubChem CID | 142680522 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | ethyl (7S)-7-[4-(dimethylamino)phenyl]-8-oxo-8-(pyridin-4-ylamino)octa-2,4-dienoate |
| SMILES | CCOC(=O)C=CC=CCC(C(=O)Nc1ccncc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H27N3O3/c1-4-29-22(27)9-7-5-6-8-21(18-10-12-20(13-11-18)26(2)3)23(28)25-19-14-16-24-17-15-19/h5-7,9-17,21H,4,8H2,1-3H3,(H,24,25,28) |
| InChIKey | XRRMZAXXRSVPRW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|