C26H31N3O4 — CID 142680511
(7S)-7-[4-(dimethylamino)phenyl]-8-[(6-methoxyquinolin-3-yl)amino]-8-oxooctanoic acid (PubChem CID 142680511) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is (7S)-7-[4-(dimethylamino)phenyl]-8-[(6-methoxyquinolin-3-yl)amino]-8-oxooctanoic acid.
| Compound Name | (7S)-7-[4-(dimethylamino)phenyl]-8-[(6-methoxyquinolin-3-yl)amino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 142680511 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (7S)-7-[4-(dimethylamino)phenyl]-8-[(6-methoxyquinolin-3-yl)amino]-8-oxooctanoic acid |
| SMILES | COc1ccc2ncc(NC(=O)[C@@H](CCCCCC(=O)O)c3ccc(N(C)C)cc3)cc2c1 |
| InChI | InChI=1S/C26H31N3O4/c1-29(2)21-11-9-18(10-12-21)23(7-5-4-6-8-25(30)31)26(32)28-20-15-19-16-22(33-3)13-14-24(19)27-17-20/h9-17,23H,4-8H2,1-3H3,(H,28,32)(H,30,31)/t23-/m0/s1 |
| InChIKey | OYCVMQDAQJEGDH-QHCPKHFHSA-N |
| XLogP | 5.07 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|