C19H18ClN3O5 — CID 142681920
methyl 4-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-1-benzofuran-3-yl]amino]oxybutanoate (PubChem CID 142681920) has the molecular formula C19H18ClN3O5 and a molecular weight of 403.82 g/mol. Its IUPAC name is methyl 4-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-1-benzofuran-3-yl]amino]oxybutanoate.
| Compound Name | methyl 4-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-1-benzofuran-3-yl]amino]oxybutanoate |
|---|---|
| PubChem CID | 142681920 |
| Molecular Formula | C19H18ClN3O5 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | methyl 4-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-1-benzofuran-3-yl]amino]oxybutanoate |
| SMILES | COC(=O)CCCONc1c(C(=O)Nc2ccc(Cl)cn2)oc2ccccc12 |
| InChI | InChI=1S/C19H18ClN3O5/c1-26-16(24)7-4-10-27-23-17-13-5-2-3-6-14(13)28-18(17)19(25)22-15-9-8-12(20)11-21-15/h2-3,5-6,8-9,11,23H,4,7,10H2,1H3,(H,21,22,25) |
| InChIKey | RMCPEEZGRSMVCM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|