C18H30Cl2InN3O — CID 142683542
1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]indiginane-2-carboxamide;dihydrochloride (PubChem CID 142683542) has the molecular formula C18H30Cl2InN3O and a molecular weight of 490.18 g/mol. Its IUPAC name is 1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]indiginane-2-carboxamide;dihydrochloride.
| Compound Name | 1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]indiginane-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 142683542 |
| Molecular Formula | C18H30Cl2InN3O |
| Molecular Weight | 490.18 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | 1-[4-[(3-methylphenyl)methyl]piperazin-1-yl]indiginane-2-carboxamide;dihydrochloride |
| SMILES | Cc1cccc(CN2CCN([In]3CCCCC3C(N)=O)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C12H17N2.C6H11NO.2ClH.In/c1-11-3-2-4-12(9-11)10-14-7-5-13-6-8-14;1-2-3-4-5-6(7)8;;;/h2-4,9H,5-8,10H2,1H3;5H,1-4H2,(H2,7,8);2*1H;/q-1;;;;+1 |
| InChIKey | QEMHVMSOIPKRAB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |