About 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol
1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol (PubChem CID 142684694) has the molecular formula C19H38O3
and a molecular weight of 314.51 g/mol. Its IUPAC name is 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol.
Molecular Properties
| Compound Name | 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol |
| PubChem CID | 142684694 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol |
| SMILES | CC(C)(C)CCCCCC(O)OOC(C)(C)C1CCCCC1 |
| InChI | InChI=1S/C19H38O3/c1-18(2,3)15-11-7-10-14-17(20)21-22-19(4,5)16-12-8-6-9-13-16/h16-17,20H,6-15H2,1-5H3 |
| InChIKey | LWSONGBIPGIPJT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol?
The IUPAC name of 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol (CID 142684694) is 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol.
What is the SMILES notation for 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol?
The canonical SMILES for 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol is CC(C)(C)CCCCCC(O)OOC(C)(C)C1CCCCC1.
What is the InChIKey of 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol?
The InChIKey is LWSONGBIPGIPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O3/c1-18(2,3)15-11-7-10-14-17(20)21-22-19(4,5)16-12-8-6-9-13-16/h16-17,20H,6-15H2,1-5H3.
What are the key properties of 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol?
1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol has a molecular weight of 314.51 g/mol, XLogP of 5.61, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclohexylpropan-2-ylperoxy)-7,7-dimethyloctan-1-ol is sourced from PubChem (CID 142684694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).