About (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane
(1R,6S)-10-bromotricyclo[4.3.1.01,6]decane (PubChem CID 14268506) has the molecular formula C10H15Br
and a molecular weight of 215.13 g/mol. Its IUPAC name is (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane.
Molecular Properties
| Compound Name | (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane |
| PubChem CID | 14268506 |
| Molecular Formula | C10H15Br |
| Molecular Weight | 215.13 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane |
| SMILES | BrC1[C@@]23CCCC[C@@]12CCC3 |
| InChI | InChI=1S/C10H15Br/c11-8-9-4-1-2-5-10(8,9)7-3-6-9/h8H,1-7H2/t8?,9-,10+ |
| InChIKey | VUZSYTXUAFIMAR-PBINXNQUSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.13 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane?
The IUPAC name of (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane (CID 14268506) is (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane.
What is the SMILES notation for (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane?
The canonical SMILES for (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane is BrC1[C@@]23CCCC[C@@]12CCC3.
What is the InChIKey of (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane?
The InChIKey is VUZSYTXUAFIMAR-PBINXNQUSA-N. The full InChI is InChI=1S/C10H15Br/c11-8-9-4-1-2-5-10(8,9)7-3-6-9/h8H,1-7H2/t8?,9-,10+.
What are the key properties of (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane?
(1R,6S)-10-bromotricyclo[4.3.1.01,6]decane has a molecular weight of 215.13 g/mol, XLogP of 3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6S)-10-bromotricyclo[4.3.1.01,6]decane is sourced from PubChem (CID 14268506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).