C20H22O2 — CID 142686311
3-ethyl-6-methoxy-2-phenyl-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde (PubChem CID 142686311) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 3-ethyl-6-methoxy-2-phenyl-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde.
| Compound Name | 3-ethyl-6-methoxy-2-phenyl-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 142686311 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-ethyl-6-methoxy-2-phenyl-1,2,3,4-tetrahydronaphthalene-1-carbaldehyde |
| SMILES | CCC1Cc2cc(OC)ccc2C(C=O)C1c1ccccc1 |
| InChI | InChI=1S/C20H22O2/c1-3-14-11-16-12-17(22-2)9-10-18(16)19(13-21)20(14)15-7-5-4-6-8-15/h4-10,12-14,19-20H,3,11H2,1-2H3 |
| InChIKey | YJQCRAHICUQWRK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|