C18H14Br4O4 — CID 142686766
1-O-benzyl 2-O-propan-2-yl 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate (PubChem CID 142686766) has the molecular formula C18H14Br4O4 and a molecular weight of 613.92 g/mol. Its IUPAC name is 1-O-benzyl 2-O-propan-2-yl 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-propan-2-yl 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142686766 |
| Molecular Formula | C18H14Br4O4 |
| Molecular Weight | 613.92 g/mol |
| Exact Mass | 609.76 |
| IUPAC Name | 1-O-benzyl 2-O-propan-2-yl 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate |
| SMILES | CC(C)OC(=O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H14Br4O4/c1-9(2)26-18(24)12-11(13(19)15(21)16(22)14(12)20)17(23)25-8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | IUWIANCAFCKRJO-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.92 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|