C11H12BrNO4 — CID 142688140
(5-bromo-2-hydroxyphenyl) morpholine-4-carboxylate (PubChem CID 142688140) has the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. Its IUPAC name is (5-bromo-2-hydroxyphenyl) morpholine-4-carboxylate.
| Compound Name | (5-bromo-2-hydroxyphenyl) morpholine-4-carboxylate |
|---|---|
| PubChem CID | 142688140 |
| Molecular Formula | C11H12BrNO4 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | (5-bromo-2-hydroxyphenyl) morpholine-4-carboxylate |
| SMILES | O=C(Oc1cc(Br)ccc1O)N1CCOCC1 |
| InChI | InChI=1S/C11H12BrNO4/c12-8-1-2-9(14)10(7-8)17-11(15)13-3-5-16-6-4-13/h1-2,7,14H,3-6H2 |
| InChIKey | IEVSBYLVYOZUQZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |