C23H24N4O3 — CID 142692328
4-[2-[3-[2-(4-methoxy-2-methylphenyl)ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxyethyl]morpholine (PubChem CID 142692328) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-[2-[3-[2-(4-methoxy-2-methylphenyl)ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxyethyl]morpholine.
| Compound Name | 4-[2-[3-[2-(4-methoxy-2-methylphenyl)ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxyethyl]morpholine |
|---|---|
| PubChem CID | 142692328 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-[2-[3-[2-(4-methoxy-2-methylphenyl)ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxyethyl]morpholine |
| SMILES | COc1ccc(C#Cc2nc3ncccc3nc2OCCN2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C23H24N4O3/c1-17-16-19(28-2)7-5-18(17)6-8-21-23(26-20-4-3-9-24-22(20)25-21)30-15-12-27-10-13-29-14-11-27/h3-5,7,9,16H,10-15H2,1-2H3 |
| InChIKey | AUJUKEMKQQVJPT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|