C14H19NO4 — CID 142693764
ethyl 1-benzyl-4,5-dihydroxypyrrolidine-3-carboxylate (PubChem CID 142693764) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is ethyl 1-benzyl-4,5-dihydroxypyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-benzyl-4,5-dihydroxypyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 142693764 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | ethyl 1-benzyl-4,5-dihydroxypyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1CN(Cc2ccccc2)C(O)C1O |
| InChI | InChI=1S/C14H19NO4/c1-2-19-14(18)11-9-15(13(17)12(11)16)8-10-6-4-3-5-7-10/h3-7,11-13,16-17H,2,8-9H2,1H3 |
| InChIKey | IRSIMQPISXQKMT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |