C27H29NO4S — CID 142694214
3-[4-[1-(benzylamino)-2-phenyl-1-sulfanylidenepropan-2-yl]oxyphenyl]-2-ethoxypropanoic acid (PubChem CID 142694214) has the molecular formula C27H29NO4S and a molecular weight of 463.60 g/mol. Its IUPAC name is 3-[4-[1-(benzylamino)-2-phenyl-1-sulfanylidenepropan-2-yl]oxyphenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[1-(benzylamino)-2-phenyl-1-sulfanylidenepropan-2-yl]oxyphenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 142694214 |
| Molecular Formula | C27H29NO4S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 3-[4-[1-(benzylamino)-2-phenyl-1-sulfanylidenepropan-2-yl]oxyphenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OC(C)(C(=S)NCc2ccccc2)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H29NO4S/c1-3-31-24(25(29)30)18-20-14-16-23(17-15-20)32-27(2,22-12-8-5-9-13-22)26(33)28-19-21-10-6-4-7-11-21/h4-17,24H,3,18-19H2,1-2H3,(H,28,33)(H,29,30) |
| InChIKey | XQQWPNYMYYXXOJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|