C32H39NO3S — CID 25106616
(2S)-3-[4-[(3S)-4-[(4-tert-butylphenyl)methylamino]-3-phenyl-4-sulfanylidenebutyl]phenyl]-2-ethoxypropanoic acid (PubChem CID 25106616) has the molecular formula C32H39NO3S and a molecular weight of 517.74 g/mol. Its IUPAC name is (2S)-3-[4-[(3S)-4-[(4-tert-butylphenyl)methylamino]-3-phenyl-4-sulfanylidenebutyl]phenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[4-[(3S)-4-[(4-tert-butylphenyl)methylamino]-3-phenyl-4-sulfanylidenebutyl]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 25106616 |
| Molecular Formula | C32H39NO3S |
| Molecular Weight | 517.74 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | (2S)-3-[4-[(3S)-4-[(4-tert-butylphenyl)methylamino]-3-phenyl-4-sulfanylidenebutyl]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(CCC(C(=S)NCc2ccc(C(C)(C)C)cc2)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C32H39NO3S/c1-5-36-29(31(34)35)21-24-13-11-23(12-14-24)17-20-28(26-9-7-6-8-10-26)30(37)33-22-25-15-18-27(19-16-25)32(2,3)4/h6-16,18-19,28-29H,5,17,20-22H2,1-4H3,(H,33,37)(H,34,35)/t28?,29-/m0/s1 |
| InChIKey | DNOVNMFKSFRRAH-XIJSCUBXSA-N |
| XLogP | 6.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.74 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|