C24H31NO3S — CID 25106354
(2R)-2-ethoxy-3-[4-[(3S)-3-phenyl-4-(propylamino)-4-sulfanylidenebutyl]phenyl]propanoic acid (PubChem CID 25106354) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is (2R)-2-ethoxy-3-[4-[(3S)-3-phenyl-4-(propylamino)-4-sulfanylidenebutyl]phenyl]propanoic acid.
| Compound Name | (2R)-2-ethoxy-3-[4-[(3S)-3-phenyl-4-(propylamino)-4-sulfanylidenebutyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 25106354 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (2R)-2-ethoxy-3-[4-[(3S)-3-phenyl-4-(propylamino)-4-sulfanylidenebutyl]phenyl]propanoic acid |
| SMILES | CCCNC(=S)C(CCc1ccc(C[C@@H](OCC)C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO3S/c1-3-16-25-23(29)21(20-8-6-5-7-9-20)15-14-18-10-12-19(13-11-18)17-22(24(26)27)28-4-2/h5-13,21-22H,3-4,14-17H2,1-2H3,(H,25,29)(H,26,27)/t21?,22-/m1/s1 |
| InChIKey | UTNCKWHOWIOCFP-FOIFJWKZSA-N |
| XLogP | 4.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|