C19H23NS — CID 101226122
N-butyl-2,3-diphenylpropanethioamide (PubChem CID 101226122) has the molecular formula C19H23NS and a molecular weight of 297.47 g/mol. Its IUPAC name is N-butyl-2,3-diphenylpropanethioamide.
| Compound Name | N-butyl-2,3-diphenylpropanethioamide |
|---|---|
| PubChem CID | 101226122 |
| Molecular Formula | C19H23NS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-butyl-2,3-diphenylpropanethioamide |
| SMILES | CCCCNC(=S)C(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NS/c1-2-3-14-20-19(21)18(17-12-8-5-9-13-17)15-16-10-6-4-7-11-16/h4-13,18H,2-3,14-15H2,1H3,(H,20,21) |
| InChIKey | WOZMMJLQIHQFEP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|