C28H37NO3S — CID 25106444
(2R)-3-[4-[(2R)-1-[cyclohexyl(methyl)amino]-4-phenyl-1-sulfanylidenebutan-2-yl]phenyl]-2-ethoxypropanoic acid (PubChem CID 25106444) has the molecular formula C28H37NO3S and a molecular weight of 467.68 g/mol. Its IUPAC name is (2R)-3-[4-[(2R)-1-[cyclohexyl(methyl)amino]-4-phenyl-1-sulfanylidenebutan-2-yl]phenyl]-2-ethoxypropanoic acid.
| Compound Name | (2R)-3-[4-[(2R)-1-[cyclohexyl(methyl)amino]-4-phenyl-1-sulfanylidenebutan-2-yl]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 25106444 |
| Molecular Formula | C28H37NO3S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | (2R)-3-[4-[(2R)-1-[cyclohexyl(methyl)amino]-4-phenyl-1-sulfanylidenebutan-2-yl]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCO[C@H](Cc1ccc([C@@H](CCc2ccccc2)C(=S)N(C)C2CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C28H37NO3S/c1-3-32-26(28(30)31)20-22-14-17-23(18-15-22)25(19-16-21-10-6-4-7-11-21)27(33)29(2)24-12-8-5-9-13-24/h4,6-7,10-11,14-15,17-18,24-26H,3,5,8-9,12-13,16,19-20H2,1-2H3,(H,30,31)/t25-,26-/m1/s1 |
| InChIKey | FAUZHOXGCBAAHB-CLJLJLNGSA-N |
| XLogP | 6.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|