C5H5F5O3S — CID 142698103
1,1,2,2,2-pentafluoroethyl prop-2-ene-1-sulfonate (PubChem CID 142698103) has the molecular formula C5H5F5O3S and a molecular weight of 240.15 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethyl prop-2-ene-1-sulfonate.
| Compound Name | 1,1,2,2,2-pentafluoroethyl prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 142698103 |
| Molecular Formula | C5H5F5O3S |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethyl prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H5F5O3S/c1-2-3-14(11,12)13-5(9,10)4(6,7)8/h2H,1,3H2 |
| InChIKey | NIPSYAMQDXZCIH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|