[3,4-bis(fluoromethyl)phenyl]boronic acid

C8H9BF2O2 — CID 142699880

IUPAC[3,4-bis(fluoromethyl)phenyl]boronic acid
SMILESOB(O)c1ccc(CF)c(CF)c1
InChIInChI=1S/C8H9BF2O2/c10-4-6-1-2-8(9(12)13)3-7(6)5-11/h1-3,12-13H,4-5H2
InChIKeySJRCIYQVTBQRAN-UHFFFAOYSA-N
MW185.97 g/mol
LogP0.31
Rot. Bonds3

About [3,4-bis(fluoromethyl)phenyl]boronic acid

[3,4-bis(fluoromethyl)phenyl]boronic acid (PubChem CID 142699880) has the molecular formula C8H9BF2O2 and a molecular weight of 185.97 g/mol. Its IUPAC name is [3,4-bis(fluoromethyl)phenyl]boronic acid.

Molecular Properties

Compound Name[3,4-bis(fluoromethyl)phenyl]boronic acid
PubChem CID142699880
Molecular FormulaC8H9BF2O2
Molecular Weight185.97 g/mol
Exact Mass186.07
IUPAC Name[3,4-bis(fluoromethyl)phenyl]boronic acid
SMILESOB(O)c1ccc(CF)c(CF)c1
InChIInChI=1S/C8H9BF2O2/c10-4-6-1-2-8(9(12)13)3-7(6)5-11/h1-3,12-13H,4-5H2
InChIKeySJRCIYQVTBQRAN-UHFFFAOYSA-N
XLogP0.31
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.97
LogP ≤ 50.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [3,4-bis(fluoromethyl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3,4-bis(fluoromethyl)phenyl]boronic acid?
The IUPAC name of [3,4-bis(fluoromethyl)phenyl]boronic acid (CID 142699880) is [3,4-bis(fluoromethyl)phenyl]boronic acid.
What is the SMILES notation for [3,4-bis(fluoromethyl)phenyl]boronic acid?
The canonical SMILES for [3,4-bis(fluoromethyl)phenyl]boronic acid is OB(O)c1ccc(CF)c(CF)c1.
What is the InChIKey of [3,4-bis(fluoromethyl)phenyl]boronic acid?
The InChIKey is SJRCIYQVTBQRAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BF2O2/c10-4-6-1-2-8(9(12)13)3-7(6)5-11/h1-3,12-13H,4-5H2.
What are the key properties of [3,4-bis(fluoromethyl)phenyl]boronic acid?
[3,4-bis(fluoromethyl)phenyl]boronic acid has a molecular weight of 185.97 g/mol, XLogP of 0.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4-bis(fluoromethyl)phenyl]boronic acid is sourced from PubChem (CID 142699880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).