C27H31NO5 — CID 142702384
N-[2-(3-methoxy-4-prop-2-ynoxyphenoxy)ethyl]-2-[(4-propylphenoxy)methyl]pent-4-ynamide (PubChem CID 142702384) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-[2-(3-methoxy-4-prop-2-ynoxyphenoxy)ethyl]-2-[(4-propylphenoxy)methyl]pent-4-ynamide.
| Compound Name | N-[2-(3-methoxy-4-prop-2-ynoxyphenoxy)ethyl]-2-[(4-propylphenoxy)methyl]pent-4-ynamide |
|---|---|
| PubChem CID | 142702384 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-[2-(3-methoxy-4-prop-2-ynoxyphenoxy)ethyl]-2-[(4-propylphenoxy)methyl]pent-4-ynamide |
| SMILES | C#CCOc1ccc(OCCNC(=O)C(CC#C)COc2ccc(CCC)cc2)cc1OC |
| InChI | InChI=1S/C27H31NO5/c1-5-8-21-10-12-23(13-11-21)33-20-22(9-6-2)27(29)28-16-18-31-24-14-15-25(32-17-7-3)26(19-24)30-4/h2-3,10-15,19,22H,5,8-9,16-18,20H2,1,4H3,(H,28,29) |
| InChIKey | LMLSFAVKXCEDQC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|