C20H20BrNO5 — CID 142702319
2-(4-bromophenyl)-2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenoxy)ethyl]acetamide (PubChem CID 142702319) has the molecular formula C20H20BrNO5 and a molecular weight of 434.29 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenoxy)ethyl]acetamide.
| Compound Name | 2-(4-bromophenyl)-2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 142702319 |
| Molecular Formula | C20H20BrNO5 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 2-(4-bromophenyl)-2-hydroxy-N-[2-(3-methoxy-4-prop-2-ynoxyphenoxy)ethyl]acetamide |
| SMILES | C#CCOc1ccc(OCCNC(=O)C(O)c2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C20H20BrNO5/c1-3-11-27-17-9-8-16(13-18(17)25-2)26-12-10-22-20(24)19(23)14-4-6-15(21)7-5-14/h1,4-9,13,19,23H,10-12H2,2H3,(H,22,24) |
| InChIKey | ACGOFLPXBDVIJX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|