C24H26ClNO4 — CID 87818490
2-(4-chlorophenyl)-2-hydroxy-N-[(1R,2S)-2-(3-methoxy-4-prop-2-ynoxyphenyl)cyclohexyl]acetamide (PubChem CID 87818490) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-hydroxy-N-[(1R,2S)-2-(3-methoxy-4-prop-2-ynoxyphenyl)cyclohexyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-2-hydroxy-N-[(1R,2S)-2-(3-methoxy-4-prop-2-ynoxyphenyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 87818490 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-(4-chlorophenyl)-2-hydroxy-N-[(1R,2S)-2-(3-methoxy-4-prop-2-ynoxyphenyl)cyclohexyl]acetamide |
| SMILES | C#CCOc1ccc([C@@H]2CCCC[C@H]2NC(=O)C(O)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C24H26ClNO4/c1-3-14-30-21-13-10-17(15-22(21)29-2)19-6-4-5-7-20(19)26-24(28)23(27)16-8-11-18(25)12-9-16/h1,8-13,15,19-20,23,27H,4-7,14H2,2H3,(H,26,28)/t19-,20+,23?/m0/s1 |
| InChIKey | BSOXPCNHZVNRIU-RCCQNZRSSA-N |
| XLogP | 4.24 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|