C28H30N2O3 — CID 142703485
2-[2-[3-[5-[2-(methoxymethyl)-3-methyl-4-phenylphenyl]-1,2-oxazol-3-yl]phenyl]ethylamino]ethanol (PubChem CID 142703485) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[2-[3-[5-[2-(methoxymethyl)-3-methyl-4-phenylphenyl]-1,2-oxazol-3-yl]phenyl]ethylamino]ethanol.
| Compound Name | 2-[2-[3-[5-[2-(methoxymethyl)-3-methyl-4-phenylphenyl]-1,2-oxazol-3-yl]phenyl]ethylamino]ethanol |
|---|---|
| PubChem CID | 142703485 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 2-[2-[3-[5-[2-(methoxymethyl)-3-methyl-4-phenylphenyl]-1,2-oxazol-3-yl]phenyl]ethylamino]ethanol |
| SMILES | COCc1c(-c2cc(-c3cccc(CCNCCO)c3)no2)ccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C28H30N2O3/c1-20-24(22-8-4-3-5-9-22)11-12-25(26(20)19-32-2)28-18-27(30-33-28)23-10-6-7-21(17-23)13-14-29-15-16-31/h3-12,17-18,29,31H,13-16,19H2,1-2H3 |
| InChIKey | WNFXWCMUCAHLGK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|