C28H26FNO5 — CID 142703542
4-[2-fluoro-4-[5-[2-(methoxymethyl)-3-methyl-4-phenylphenyl]-1,2-oxazol-3-yl]phenoxy]butanoic acid (PubChem CID 142703542) has the molecular formula C28H26FNO5 and a molecular weight of 475.52 g/mol. Its IUPAC name is 4-[2-fluoro-4-[5-[2-(methoxymethyl)-3-methyl-4-phenylphenyl]-1,2-oxazol-3-yl]phenoxy]butanoic acid.
| Compound Name | 4-[2-fluoro-4-[5-[2-(methoxymethyl)-3-methyl-4-phenylphenyl]-1,2-oxazol-3-yl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 142703542 |
| Molecular Formula | C28H26FNO5 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 4-[2-fluoro-4-[5-[2-(methoxymethyl)-3-methyl-4-phenylphenyl]-1,2-oxazol-3-yl]phenoxy]butanoic acid |
| SMILES | COCc1c(-c2cc(-c3ccc(OCCCC(=O)O)c(F)c3)no2)ccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C28H26FNO5/c1-18-21(19-7-4-3-5-8-19)11-12-22(23(18)17-33-2)27-16-25(30-35-27)20-10-13-26(24(29)15-20)34-14-6-9-28(31)32/h3-5,7-8,10-13,15-16H,6,9,14,17H2,1-2H3,(H,31,32) |
| InChIKey | IZATVTXBHLWAJF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|