C27H27NO4 — CID 142703553
2-[[3-[5-[2-(methoxymethyl)-3-methyl-4-phenylphenyl]-1,2-oxazol-3-yl]phenyl]methoxy]ethanol (PubChem CID 142703553) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[[3-[5-[2-(methoxymethyl)-3-methyl-4-phenylphenyl]-1,2-oxazol-3-yl]phenyl]methoxy]ethanol.
| Compound Name | 2-[[3-[5-[2-(methoxymethyl)-3-methyl-4-phenylphenyl]-1,2-oxazol-3-yl]phenyl]methoxy]ethanol |
|---|---|
| PubChem CID | 142703553 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-[[3-[5-[2-(methoxymethyl)-3-methyl-4-phenylphenyl]-1,2-oxazol-3-yl]phenyl]methoxy]ethanol |
| SMILES | COCc1c(-c2cc(-c3cccc(COCCO)c3)no2)ccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C27H27NO4/c1-19-23(21-8-4-3-5-9-21)11-12-24(25(19)18-30-2)27-16-26(28-32-27)22-10-6-7-20(15-22)17-31-14-13-29/h3-12,15-16,29H,13-14,17-18H2,1-2H3 |
| InChIKey | DXQVOCNYSCCKQT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|