C6H11N3O — CID 142703620
4-(aminomethyl)-6-methyl-1,2-dihydropyrazin-3-one (PubChem CID 142703620) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is 4-(aminomethyl)-6-methyl-1,2-dihydropyrazin-3-one.
| Compound Name | 4-(aminomethyl)-6-methyl-1,2-dihydropyrazin-3-one |
|---|---|
| PubChem CID | 142703620 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 4-(aminomethyl)-6-methyl-1,2-dihydropyrazin-3-one |
| SMILES | CC1=CN(CN)C(=O)CN1 |
| InChI | InChI=1S/C6H11N3O/c1-5-3-9(4-7)6(10)2-8-5/h3,8H,2,4,7H2,1H3 |
| InChIKey | MVTCWOVAQJCWRQ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |