C6H8N2O2 — CID 20646804
4,6-dimethyl-1H-pyrazine-2,3-dione (PubChem CID 20646804) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is 4,6-dimethyl-1H-pyrazine-2,3-dione.
| Compound Name | 4,6-dimethyl-1H-pyrazine-2,3-dione |
|---|---|
| PubChem CID | 20646804 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 4,6-dimethyl-1H-pyrazine-2,3-dione |
| SMILES | Cc1cn(C)c(=O)c(=O)[nH]1 |
| InChI | InChI=1S/C6H8N2O2/c1-4-3-8(2)6(10)5(9)7-4/h3H,1-2H3,(H,7,9) |
| InChIKey | FJCCEFBPZCRTHQ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|