C6H10N2O — CID 146684659
2,5-dimethyl-2,4-dihydro-1H-pyrazin-3-one (PubChem CID 146684659) has the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. Its IUPAC name is 2,5-dimethyl-2,4-dihydro-1H-pyrazin-3-one.
| Compound Name | 2,5-dimethyl-2,4-dihydro-1H-pyrazin-3-one |
|---|---|
| PubChem CID | 146684659 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 2,5-dimethyl-2,4-dihydro-1H-pyrazin-3-one |
| SMILES | CC1=CNC(C)C(=O)N1 |
| InChI | InChI=1S/C6H10N2O/c1-4-3-7-5(2)6(9)8-4/h3,5,7H,1-2H3,(H,8,9) |
| InChIKey | BUILUXASNMUODO-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |