About 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide
3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide (PubChem CID 141358739) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide.
Molecular Properties
| Compound Name | 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide |
| PubChem CID | 141358739 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide |
| SMILES | CN1C=CCNC1C(N)=O |
| InChI | InChI=1S/C6H11N3O/c1-9-4-2-3-8-6(9)5(7)10/h2,4,6,8H,3H2,1H3,(H2,7,10) |
| InChIKey | MYWTXNNHXKGMGP-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide?
The IUPAC name of 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide (CID 141358739) is 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide.
What is the SMILES notation for 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide?
The canonical SMILES for 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide is CN1C=CCNC1C(N)=O.
What is the InChIKey of 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide?
The InChIKey is MYWTXNNHXKGMGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-9-4-2-3-8-6(9)5(7)10/h2,4,6,8H,3H2,1H3,(H2,7,10).
What are the key properties of 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide?
3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide has a molecular weight of 141.17 g/mol, XLogP of -1.15, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide is sourced from PubChem (CID 141358739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).