C6H11N3O — CID 141358739
3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide (PubChem CID 141358739) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide.
| Compound Name | 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 141358739 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 3-methyl-2,6-dihydro-1H-pyrimidine-2-carboxamide |
| SMILES | CN1C=CCNC1C(N)=O |
| InChI | InChI=1S/C6H11N3O/c1-9-4-2-3-8-6(9)5(7)10/h2,4,6,8H,3H2,1H3,(H2,7,10) |
| InChIKey | MYWTXNNHXKGMGP-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |