C27H28N4O2S — CID 142704800
N-[[3-(4-methylpiperazin-1-yl)phenyl]methyl]-N-pyridin-3-ylnaphthalene-2-sulfonamide (PubChem CID 142704800) has the molecular formula C27H28N4O2S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-[[3-(4-methylpiperazin-1-yl)phenyl]methyl]-N-pyridin-3-ylnaphthalene-2-sulfonamide.
| Compound Name | N-[[3-(4-methylpiperazin-1-yl)phenyl]methyl]-N-pyridin-3-ylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 142704800 |
| Molecular Formula | C27H28N4O2S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-[[3-(4-methylpiperazin-1-yl)phenyl]methyl]-N-pyridin-3-ylnaphthalene-2-sulfonamide |
| SMILES | CN1CCN(c2cccc(CN(c3cccnc3)S(=O)(=O)c3ccc4ccccc4c3)c2)CC1 |
| InChI | InChI=1S/C27H28N4O2S/c1-29-14-16-30(17-15-29)25-9-4-6-22(18-25)21-31(26-10-5-13-28-20-26)34(32,33)27-12-11-23-7-2-3-8-24(23)19-27/h2-13,18-20H,14-17,21H2,1H3 |
| InChIKey | FMBUHOUWPVHINZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |