C21H35NO2 — CID 142705738
(4S,5R)-5-anilinooxypentadec-1-en-4-ol (PubChem CID 142705738) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is (4S,5R)-5-anilinooxypentadec-1-en-4-ol.
| Compound Name | (4S,5R)-5-anilinooxypentadec-1-en-4-ol |
|---|---|
| PubChem CID | 142705738 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | (4S,5R)-5-anilinooxypentadec-1-en-4-ol |
| SMILES | C=CC[C@H](O)[C@@H](CCCCCCCCCC)ONc1ccccc1 |
| InChI | InChI=1S/C21H35NO2/c1-3-5-6-7-8-9-10-14-18-21(20(23)15-4-2)24-22-19-16-12-11-13-17-19/h4,11-13,16-17,20-23H,2-3,5-10,14-15,18H2,1H3/t20-,21+/m0/s1 |
| InChIKey | ABTJFGZWRGPDML-LEWJYISDSA-N |
| XLogP | 5.87 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|