C22H21F6N5O4S — CID 142705991
[(2R)-4-oxo-4-[1-(1,3-thiazolidine-3-carbonyl)-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamic acid (PubChem CID 142705991) has the molecular formula C22H21F6N5O4S and a molecular weight of 565.50 g/mol. Its IUPAC name is [(2R)-4-oxo-4-[1-(1,3-thiazolidine-3-carbonyl)-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamic acid.
| Compound Name | [(2R)-4-oxo-4-[1-(1,3-thiazolidine-3-carbonyl)-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 142705991 |
| Molecular Formula | C22H21F6N5O4S |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | [(2R)-4-oxo-4-[1-(1,3-thiazolidine-3-carbonyl)-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](CC(=O)N1CCn2c(C(F)(F)F)nc(C(=O)N3CCSC3)c2C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H21F6N5O4S/c23-13-8-15(25)14(24)6-11(13)5-12(29-21(36)37)7-17(34)31-1-2-33-16(9-31)18(30-20(33)22(26,27)28)19(35)32-3-4-38-10-32/h6,8,12,29H,1-5,7,9-10H2,(H,36,37)/t12-/m1/s1 |
| InChIKey | QEXSKFQXHVYXRH-GFCCVEGCSA-N |
| XLogP | 3.08 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|