C26H28F6N6O4 — CID 170338813
[(2R)-4-[1-[(2-methyl-2-azaspiro[3.3]heptan-6-yl)carbamoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamic acid (PubChem CID 170338813) has the molecular formula C26H28F6N6O4 and a molecular weight of 602.54 g/mol. Its IUPAC name is [(2R)-4-[1-[(2-methyl-2-azaspiro[3.3]heptan-6-yl)carbamoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamic acid.
| Compound Name | [(2R)-4-[1-[(2-methyl-2-azaspiro[3.3]heptan-6-yl)carbamoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 170338813 |
| Molecular Formula | C26H28F6N6O4 |
| Molecular Weight | 602.54 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | [(2R)-4-[1-[(2-methyl-2-azaspiro[3.3]heptan-6-yl)carbamoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamic acid |
| SMILES | CN1CC2(CC(NC(=O)c3nc(C(F)(F)F)n4c3CN(C(=O)C[C@@H](Cc3cc(F)c(F)cc3F)NC(=O)O)CC4)C2)C1 |
| InChI | InChI=1S/C26H28F6N6O4/c1-36-11-25(12-36)8-15(9-25)33-22(40)21-19-10-37(2-3-38(19)23(35-21)26(30,31)32)20(39)6-14(34-24(41)42)4-13-5-17(28)18(29)7-16(13)27/h5,7,14-15,34H,2-4,6,8-12H2,1H3,(H,33,40)(H,41,42)/t14-/m1/s1 |
| InChIKey | HZGPBRSCCAHANT-CQSZACIVSA-N |
| XLogP | 2.75 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|