C7H11NO — CID 142706917
2,6-dimethyl-3,5-dihydro-2H-pyridin-4-one (PubChem CID 142706917) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 2,6-dimethyl-3,5-dihydro-2H-pyridin-4-one.
| Compound Name | 2,6-dimethyl-3,5-dihydro-2H-pyridin-4-one |
|---|---|
| PubChem CID | 142706917 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 2,6-dimethyl-3,5-dihydro-2H-pyridin-4-one |
| SMILES | CC1=NC(C)CC(=O)C1 |
| InChI | InChI=1S/C7H11NO/c1-5-3-7(9)4-6(2)8-5/h5H,3-4H2,1-2H3 |
| InChIKey | BPJMKTNOGWANGN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |