C7H6BrIO2 — CID 142708648
methyl 5-bromo-1λ3-iodacyclohexa-1,3,5-triene-2-carboxylate (PubChem CID 142708648) has the molecular formula C7H6BrIO2 and a molecular weight of 328.93 g/mol. Its IUPAC name is methyl 5-bromo-1λ3-iodacyclohexa-1,3,5-triene-2-carboxylate.
| Compound Name | methyl 5-bromo-1λ3-iodacyclohexa-1,3,5-triene-2-carboxylate |
|---|---|
| PubChem CID | 142708648 |
| Molecular Formula | C7H6BrIO2 |
| Molecular Weight | 328.93 g/mol |
| Exact Mass | 327.86 |
| IUPAC Name | methyl 5-bromo-1λ3-iodacyclohexa-1,3,5-triene-2-carboxylate |
| SMILES | COC(=O)C1=IC=C(Br)C=C1 |
| InChI | InChI=1S/C7H6BrIO2/c1-11-7(10)6-3-2-5(8)4-9-6/h2-4H,1H3 |
| InChIKey | KTDRHFDOXASONI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.93 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|