C6H6INO2 — CID 142705607
methyl 1λ3-ioda-3-azacyclohexa-2,4,6-triene-6-carboxylate (PubChem CID 142705607) has the molecular formula C6H6INO2 and a molecular weight of 251.02 g/mol. Its IUPAC name is methyl 1λ3-ioda-3-azacyclohexa-2,4,6-triene-6-carboxylate.
| Compound Name | methyl 1λ3-ioda-3-azacyclohexa-2,4,6-triene-6-carboxylate |
|---|---|
| PubChem CID | 142705607 |
| Molecular Formula | C6H6INO2 |
| Molecular Weight | 251.02 g/mol |
| Exact Mass | 250.94 |
| IUPAC Name | methyl 1λ3-ioda-3-azacyclohexa-2,4,6-triene-6-carboxylate |
| SMILES | COC(=O)C1=IC=NC=C1 |
| InChI | InChI=1S/C6H6INO2/c1-10-6(9)5-2-3-8-4-7-5/h2-4H,1H3 |
| InChIKey | WRLSBXQAHFUKOE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.02 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|