C7H13ClN2O2 — CID 142708658
3-(3-methyl-1H-imidazol-3-ium-2-yl)propane-1,1-diol chloride (PubChem CID 142708658) has the molecular formula C7H13ClN2O2 and a molecular weight of 192.65 g/mol. Its IUPAC name is 3-(3-methyl-1H-imidazol-3-ium-2-yl)propane-1,1-diol chloride.
| Compound Name | 3-(3-methyl-1H-imidazol-3-ium-2-yl)propane-1,1-diol chloride |
|---|---|
| PubChem CID | 142708658 |
| Molecular Formula | C7H13ClN2O2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 3-(3-methyl-1H-imidazol-3-ium-2-yl)propane-1,1-diol chloride |
| SMILES | C[n+]1cc[nH]c1CCC(O)O.[Cl-] |
| InChI | InChI=1S/C7H12N2O2.ClH/c1-9-5-4-8-6(9)2-3-7(10)11;/h4-5,7,10-11H,2-3H2,1H3;1H |
| InChIKey | AMXYVBOTTABSJP-UHFFFAOYSA-N |
| XLogP | -3.91 |
| TPSA | 60.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|