C12H17N4+ — CID 173286354
4-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]benzene-1,3-diamine (PubChem CID 173286354) has the molecular formula C12H17N4+ and a molecular weight of 217.30 g/mol. Its IUPAC name is 4-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]benzene-1,3-diamine.
| Compound Name | 4-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 173286354 |
| Molecular Formula | C12H17N4+ |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 4-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]benzene-1,3-diamine |
| SMILES | C[n+]1cc[nH]c1CCc1ccc(N)cc1N |
| InChI | InChI=1S/C12H16N4/c1-16-7-6-15-12(16)5-3-9-2-4-10(13)8-11(9)14/h2,4,6-8H,3,5,13-14H2,1H3/p+1 |
| InChIKey | HVFXVBVAIAYJHN-UHFFFAOYSA-O |
| XLogP | 0.79 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|