C27H27N5O2 — CID 142709338
4-(4-methoxyphenyl)-N-[2-(4-methylpiperazin-1-yl)quinoxalin-6-yl]benzamide (PubChem CID 142709338) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-[2-(4-methylpiperazin-1-yl)quinoxalin-6-yl]benzamide.
| Compound Name | 4-(4-methoxyphenyl)-N-[2-(4-methylpiperazin-1-yl)quinoxalin-6-yl]benzamide |
|---|---|
| PubChem CID | 142709338 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-[2-(4-methylpiperazin-1-yl)quinoxalin-6-yl]benzamide |
| SMILES | COc1ccc(-c2ccc(C(=O)Nc3ccc4nc(N5CCN(C)CC5)cnc4c3)cc2)cc1 |
| InChI | InChI=1S/C27H27N5O2/c1-31-13-15-32(16-14-31)26-18-28-25-17-22(9-12-24(25)30-26)29-27(33)21-5-3-19(4-6-21)20-7-10-23(34-2)11-8-20/h3-12,17-18H,13-16H2,1-2H3,(H,29,33) |
| InChIKey | ATYPRWNXLCTBOS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |