C12H20O6 — CID 142709377
tert-butyl 2-(5-formyl-2-methoxy-1,3-dioxan-4-yl)acetate (PubChem CID 142709377) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is tert-butyl 2-(5-formyl-2-methoxy-1,3-dioxan-4-yl)acetate.
| Compound Name | tert-butyl 2-(5-formyl-2-methoxy-1,3-dioxan-4-yl)acetate |
|---|---|
| PubChem CID | 142709377 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | tert-butyl 2-(5-formyl-2-methoxy-1,3-dioxan-4-yl)acetate |
| SMILES | COC1OCC(C=O)C(CC(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C12H20O6/c1-12(2,3)18-10(14)5-9-8(6-13)7-16-11(15-4)17-9/h6,8-9,11H,5,7H2,1-4H3 |
| InChIKey | YQNXZDUSWGUIDS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|