C38H39F7O7S2 — CID 142711954
[6-[diphenyl-[4-(3,3,3-trifluoropropanoyloxy)phenyl]-λ4-sulfanyl]oxysulfonyl-5,5,6,6-tetrafluorohexyl] adamantane-1-carboxylate (PubChem CID 142711954) has the molecular formula C38H39F7O7S2 and a molecular weight of 804.84 g/mol. Its IUPAC name is [6-[diphenyl-[4-(3,3,3-trifluoropropanoyloxy)phenyl]-λ4-sulfanyl]oxysulfonyl-5,5,6,6-tetrafluorohexyl] adamantane-1-carboxylate.
| Compound Name | [6-[diphenyl-[4-(3,3,3-trifluoropropanoyloxy)phenyl]-λ4-sulfanyl]oxysulfonyl-5,5,6,6-tetrafluorohexyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 142711954 |
| Molecular Formula | C38H39F7O7S2 |
| Molecular Weight | 804.84 g/mol |
| Exact Mass | 804.20 |
| IUPAC Name | [6-[diphenyl-[4-(3,3,3-trifluoropropanoyloxy)phenyl]-λ4-sulfanyl]oxysulfonyl-5,5,6,6-tetrafluorohexyl] adamantane-1-carboxylate |
| SMILES | O=C(CC(F)(F)F)Oc1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)CCCCOC(=O)C23CC4CC(CC(C4)C2)C3)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H39F7O7S2/c39-36(40,17-7-8-18-50-34(47)35-22-26-19-27(23-35)21-28(20-26)24-35)38(44,45)54(48,49)52-53(30-9-3-1-4-10-30,31-11-5-2-6-12-31)32-15-13-29(14-16-32)51-33(46)25-37(41,42)43/h1-6,9-16,26-28H,7-8,17-25H2 |
| InChIKey | HBPPZQNMWNBRTI-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.84 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|