C11H24N4Si — CID 142712021
2-methyl-N-[2-(4-trimethylsilyltriazol-1-yl)ethyl]propan-2-amine (PubChem CID 142712021) has the molecular formula C11H24N4Si and a molecular weight of 240.43 g/mol. Its IUPAC name is 2-methyl-N-[2-(4-trimethylsilyltriazol-1-yl)ethyl]propan-2-amine.
| Compound Name | 2-methyl-N-[2-(4-trimethylsilyltriazol-1-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 142712021 |
| Molecular Formula | C11H24N4Si |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 2-methyl-N-[2-(4-trimethylsilyltriazol-1-yl)ethyl]propan-2-amine |
| SMILES | CC(C)(C)NCCn1cc([Si](C)(C)C)nn1 |
| InChI | InChI=1S/C11H24N4Si/c1-11(2,3)12-7-8-15-9-10(13-14-15)16(4,5)6/h9,12H,7-8H2,1-6H3 |
| InChIKey | DQOZIDLGRLGWRL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|