C26H18ClF4N3O2 — CID 142714502
[4-(3-chlorophenyl)piperazin-1-yl]-[4-(4-fluorophenyl)-2-(2,3,4-trifluorophenyl)-1,3-oxazol-5-yl]methanone (PubChem CID 142714502) has the molecular formula C26H18ClF4N3O2 and a molecular weight of 515.89 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-[4-(4-fluorophenyl)-2-(2,3,4-trifluorophenyl)-1,3-oxazol-5-yl]methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-[4-(4-fluorophenyl)-2-(2,3,4-trifluorophenyl)-1,3-oxazol-5-yl]methanone |
|---|---|
| PubChem CID | 142714502 |
| Molecular Formula | C26H18ClF4N3O2 |
| Molecular Weight | 515.89 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-[4-(4-fluorophenyl)-2-(2,3,4-trifluorophenyl)-1,3-oxazol-5-yl]methanone |
| SMILES | O=C(c1oc(-c2ccc(F)c(F)c2F)nc1-c1ccc(F)cc1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C26H18ClF4N3O2/c27-16-2-1-3-18(14-16)33-10-12-34(13-11-33)26(35)24-23(15-4-6-17(28)7-5-15)32-25(36-24)19-8-9-20(29)22(31)21(19)30/h1-9,14H,10-13H2 |
| InChIKey | HTZGSNGSDNNCHB-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.89 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|